C11H14FN2O8PS — CID 162744714
[3-[(2S,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]thietan-3-yl] dihydrogen phosphate (PubChem CID 162744714) has the molecular formula C11H14FN2O8PS and a molecular weight of 384.28 g/mol. Its IUPAC name is [3-[(2S,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]thietan-3-yl] dihydrogen phosphate.
| Compound Name | [3-[(2S,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]thietan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 162744714 |
| Molecular Formula | C11H14FN2O8PS |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | [3-[(2S,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]thietan-3-yl] dihydrogen phosphate |
| SMILES | O=c1[nH]c(=O)n([C@H]2C[C@H](O)[C@@H](C3(OP(=O)(O)O)CSC3)O2)cc1F |
| InChI | InChI=1S/C11H14FN2O8PS/c12-5-2-14(10(17)13-9(5)16)7-1-6(15)8(21-7)11(3-24-4-11)22-23(18,19)20/h2,6-8,15H,1,3-4H2,(H,13,16,17)(H2,18,19,20)/t6-,7+,8-/m0/s1 |
| InChIKey | JPXUCCVDEMXHQI-RNJXMRFFSA-N |
| XLogP | -1.08 |
| TPSA | 151.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|