C10H11FN3O8P — CID 170689150
[(S)-cyano-[(2S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl] dihydrogen phosphate (PubChem CID 170689150) has the molecular formula C10H11FN3O8P and a molecular weight of 351.18 g/mol. Its IUPAC name is [(S)-cyano-[(2S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl] dihydrogen phosphate.
| Compound Name | [(S)-cyano-[(2S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 170689150 |
| Molecular Formula | C10H11FN3O8P |
| Molecular Weight | 351.18 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | [(S)-cyano-[(2S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl] dihydrogen phosphate |
| SMILES | N#C[C@H](OP(=O)(O)O)[C@H]1O[C@@H](n2cc(F)c(=O)[nH]c2=O)CC1O |
| InChI | InChI=1S/C10H11FN3O8P/c11-4-3-14(10(17)13-9(4)16)7-1-5(15)8(21-7)6(2-12)22-23(18,19)20/h3,5-8,15H,1H2,(H,13,16,17)(H2,18,19,20)/t5?,6-,7+,8-/m0/s1 |
| InChIKey | NOUKNEWDWYWIKC-VMEVTNHQSA-N |
| XLogP | -1.67 |
| TPSA | 174.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.18 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|