C10H12FN2O8P — CID 170689089
1-[(2S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]ethenyl dihydrogen phosphate (PubChem CID 170689089) has the molecular formula C10H12FN2O8P and a molecular weight of 338.18 g/mol. Its IUPAC name is 1-[(2S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]ethenyl dihydrogen phosphate.
| Compound Name | 1-[(2S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]ethenyl dihydrogen phosphate |
|---|---|
| PubChem CID | 170689089 |
| Molecular Formula | C10H12FN2O8P |
| Molecular Weight | 338.18 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 1-[(2S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]ethenyl dihydrogen phosphate |
| SMILES | C=C(OP(=O)(O)O)[C@H]1O[C@@H](n2cc(F)c(=O)[nH]c2=O)CC1O |
| InChI | InChI=1S/C10H12FN2O8P/c1-4(21-22(17,18)19)8-6(14)2-7(20-8)13-3-5(11)9(15)12-10(13)16/h3,6-8,14H,1-2H2,(H,12,15,16)(H2,17,18,19)/t6?,7-,8-/m1/s1 |
| InChIKey | MAEXWWIGTJANKZ-SPDVFEMOSA-N |
| XLogP | -1.05 |
| TPSA | 151.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.18 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|