C11H14FLi2N2O8P — CID 162744433
dilithium;2-[(2S,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]propan-2-yl phosphate (PubChem CID 162744433) has the molecular formula C11H14FLi2N2O8P and a molecular weight of 366.09 g/mol. Its IUPAC name is dilithium;2-[(2S,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]propan-2-yl phosphate.
| Compound Name | dilithium;2-[(2S,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]propan-2-yl phosphate |
|---|---|
| PubChem CID | 162744433 |
| Molecular Formula | C11H14FLi2N2O8P |
| Molecular Weight | 366.09 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | dilithium;2-[(2S,3S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]propan-2-yl phosphate |
| SMILES | CC(C)(OP(=O)([O-])[O-])[C@H]1O[C@@H](n2cc(F)c(=O)[nH]c2=O)C[C@@H]1O.[Li+].[Li+] |
| InChI | InChI=1S/C11H16FN2O8P.2Li/c1-11(2,22-23(18,19)20)8-6(15)3-7(21-8)14-4-5(12)9(16)13-10(14)17;;/h4,6-8,15H,3H2,1-2H3,(H,13,16,17)(H2,18,19,20);;/q;2*+1/p-2/t6-,7+,8-;;/m0../s1 |
| InChIKey | FTNDWXCODBKREE-SGQZNDNTSA-L |
| XLogP | -8.04 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.09 |
| LogP ≤ 5 | -8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|