C19H23FN7O11P — CID 71431397
[1-[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-1-[5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]ethyl] dihydrogen phosphate (PubChem CID 71431397) has the molecular formula C19H23FN7O11P and a molecular weight of 575.40 g/mol. Its IUPAC name is [1-[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-1-[5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]ethyl] dihydrogen phosphate.
| Compound Name | [1-[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-1-[5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]ethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 71431397 |
| Molecular Formula | C19H23FN7O11P |
| Molecular Weight | 575.40 g/mol |
| Exact Mass | 575.12 |
| IUPAC Name | [1-[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-1-[5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]ethyl] dihydrogen phosphate |
| SMILES | Cc1cn(C2CC(N=[N+]=[N-])C(C(C)(OP(=O)(O)O)C3OC(n4cc(F)c(=O)[nH]c4=O)CC3O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H23FN7O11P/c1-7-5-26(17(31)22-15(7)29)11-3-9(24-25-21)13(36-11)19(2,38-39(33,34)35)14-10(28)4-12(37-14)27-6-8(20)16(30)23-18(27)32/h5-6,9-14,28H,3-4H2,1-2H3,(H,22,29,31)(H,23,30,32)(H2,33,34,35) |
| InChIKey | PAIYRTVFFKCXEE-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 263.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.40 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|