C10H14N6O5 — CID 146077738
azanium 3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-2-carboxylate (PubChem CID 146077738) has the molecular formula C10H14N6O5 and a molecular weight of 298.26 g/mol. Its IUPAC name is azanium 3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-2-carboxylate.
| Compound Name | azanium 3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-2-carboxylate |
|---|---|
| PubChem CID | 146077738 |
| Molecular Formula | C10H14N6O5 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | azanium 3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-2-carboxylate |
| SMILES | Cc1cn(C2CC(N=[N+]=[N-])C(C(=O)[O-])O2)c(=O)[nH]c1=O.[NH4+] |
| InChI | InChI=1S/C10H11N5O5.H3N/c1-4-3-15(10(19)12-8(4)16)6-2-5(13-14-11)7(20-6)9(17)18;/h3,5-7H,2H2,1H3,(H,17,18)(H,12,16,19);1H3 |
| InChIKey | BSTWOEDKMWFCFP-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 189.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|