C13H17FN2O5 — CID 91248625
5-fluoro-1-(4-hydroxy-5-pentanoyloxolan-2-yl)pyrimidine-2,4-dione (PubChem CID 91248625) has the molecular formula C13H17FN2O5 and a molecular weight of 300.29 g/mol. Its IUPAC name is 5-fluoro-1-(4-hydroxy-5-pentanoyloxolan-2-yl)pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-(4-hydroxy-5-pentanoyloxolan-2-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 91248625 |
| Molecular Formula | C13H17FN2O5 |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 5-fluoro-1-(4-hydroxy-5-pentanoyloxolan-2-yl)pyrimidine-2,4-dione |
| SMILES | CCCCC(=O)C1OC(n2cc(F)c(=O)[nH]c2=O)CC1O |
| InChI | InChI=1S/C13H17FN2O5/c1-2-3-4-8(17)11-9(18)5-10(21-11)16-6-7(14)12(19)15-13(16)20/h6,9-11,18H,2-5H2,1H3,(H,15,19,20) |
| InChIKey | UFXCLWPYOZAREI-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |