C17H25FN2O6 — CID 155890299
5-fluoro-1-[(4S)-4-hydroxy-5-(hydroxymethyl)-4-octanoyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 155890299) has the molecular formula C17H25FN2O6 and a molecular weight of 372.39 g/mol. Its IUPAC name is 5-fluoro-1-[(4S)-4-hydroxy-5-(hydroxymethyl)-4-octanoyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-[(4S)-4-hydroxy-5-(hydroxymethyl)-4-octanoyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 155890299 |
| Molecular Formula | C17H25FN2O6 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 5-fluoro-1-[(4S)-4-hydroxy-5-(hydroxymethyl)-4-octanoyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCCCCCCC(=O)[C@]1(O)CC(n2cc(F)c(=O)[nH]c2=O)OC1CO |
| InChI | InChI=1S/C17H25FN2O6/c1-2-3-4-5-6-7-12(22)17(25)8-14(26-13(17)10-21)20-9-11(18)15(23)19-16(20)24/h9,13-14,21,25H,2-8,10H2,1H3,(H,19,23,24)/t13?,14?,17-/m1/s1 |
| InChIKey | UDPBIYMTQDYQSE-MQBCKMQZSA-N |
| XLogP | 0.62 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|