C15H21FN2O7 — CID 154304601
5-fluoro-1-[(2S,3R,4S,5R)-2-hexanoyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 154304601) has the molecular formula C15H21FN2O7 and a molecular weight of 360.34 g/mol. Its IUPAC name is 5-fluoro-1-[(2S,3R,4S,5R)-2-hexanoyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-[(2S,3R,4S,5R)-2-hexanoyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 154304601 |
| Molecular Formula | C15H21FN2O7 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 5-fluoro-1-[(2S,3R,4S,5R)-2-hexanoyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCCCCC(=O)[C@@]1(n2cc(F)c(=O)[nH]c2=O)O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H21FN2O7/c1-2-3-4-5-10(20)15(12(22)11(21)9(7-19)25-15)18-6-8(16)13(23)17-14(18)24/h6,9,11-12,19,21-22H,2-5,7H2,1H3,(H,17,23,24)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | OYKSQHMWDGUQSF-SDBHATRESA-N |
| XLogP | -1.41 |
| TPSA | 141.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|