C15H22N2O8 — CID 155408771
[(2S,3R,4S,5R)-2-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] hexanoate (PubChem CID 155408771) has the molecular formula C15H22N2O8 and a molecular weight of 358.35 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-2-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] hexanoate.
| Compound Name | [(2S,3R,4S,5R)-2-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] hexanoate |
|---|---|
| PubChem CID | 155408771 |
| Molecular Formula | C15H22N2O8 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | [(2S,3R,4S,5R)-2-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] hexanoate |
| SMILES | CCCCCC(=O)O[C@@]1(n2ccc(=O)[nH]c2=O)O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H22N2O8/c1-2-3-4-5-11(20)25-15(13(22)12(21)9(8-18)24-15)17-7-6-10(19)16-14(17)23/h6-7,9,12-13,18,21-22H,2-5,8H2,1H3,(H,16,19,23)/t9-,12-,13-,15+/m1/s1 |
| InChIKey | LHEYXLYZODTRNW-OBEQPXDXSA-N |
| XLogP | -1.62 |
| TPSA | 151.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|