C11H17N2O6Si — CID 163212134
CID 163212134 (PubChem CID 163212134) has the molecular formula C11H17N2O6Si and a molecular weight of 301.35 g/mol.
| Compound Name | CID 163212134 |
|---|---|
| PubChem CID | 163212134 |
| Molecular Formula | C11H17N2O6Si |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | — |
| SMILES | C[Si](C)[C@@]1(n2ccc(=O)[nH]c2=O)O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H17N2O6Si/c1-20(2)11(9(17)8(16)6(5-14)19-11)13-4-3-7(15)12-10(13)18/h3-4,6,8-9,14,16-17H,5H2,1-2H3,(H,12,15,18)/t6-,8-,9-,11+/m1/s1 |
| InChIKey | PYIGBZKNWUPRNV-AAQQEJRNSA-N |
| XLogP | -2.40 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|