C11H13BrN2O6 — CID 87294407
1-[(2R,3R,4S,5R)-2-[(E)-2-bromoethenyl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 87294407) has the molecular formula C11H13BrN2O6 and a molecular weight of 349.14 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-2-[(E)-2-bromoethenyl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-2-[(E)-2-bromoethenyl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 87294407 |
| Molecular Formula | C11H13BrN2O6 |
| Molecular Weight | 349.14 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-2-[(E)-2-bromoethenyl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@]2(/C=C/Br)O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C11H13BrN2O6/c12-3-2-11(9(18)8(17)6(5-15)20-11)14-4-1-7(16)13-10(14)19/h1-4,6,8-9,15,17-18H,5H2,(H,13,16,19)/b3-2+/t6-,8-,9-,11-/m1/s1 |
| InChIKey | RVRQZZRCYLNQKV-FSUCTETFSA-N |
| XLogP | -1.79 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.14 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |