C10H10BrN3O5 — CID 10568534
(2R,3S,4R,5R)-3-bromo-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolane-2-carbonitrile (PubChem CID 10568534) has the molecular formula C10H10BrN3O5 and a molecular weight of 332.11 g/mol. Its IUPAC name is (2R,3S,4R,5R)-3-bromo-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolane-2-carbonitrile.
| Compound Name | (2R,3S,4R,5R)-3-bromo-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolane-2-carbonitrile |
|---|---|
| PubChem CID | 10568534 |
| Molecular Formula | C10H10BrN3O5 |
| Molecular Weight | 332.11 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | (2R,3S,4R,5R)-3-bromo-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolane-2-carbonitrile |
| SMILES | N#C[C@@]1(n2ccc(=O)[nH]c2=O)O[C@H](CO)[C@@H](O)[C@@H]1Br |
| InChI | InChI=1S/C10H10BrN3O5/c11-8-7(17)5(3-15)19-10(8,4-12)14-2-1-6(16)13-9(14)18/h1-2,5,7-8,15,17H,3H2,(H,13,16,18)/t5-,7-,8+,10-/m1/s1 |
| InChIKey | BLVOFOSUKLPRIV-PJGXCUNHSA-N |
| XLogP | -1.77 |
| TPSA | 128.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.11 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|