C12H16N2O7 — CID 90013430
1-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-propanoyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 90013430) has the molecular formula C12H16N2O7 and a molecular weight of 300.27 g/mol. Its IUPAC name is 1-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-propanoyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-propanoyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90013430 |
| Molecular Formula | C12H16N2O7 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 1-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-propanoyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCC(=O)[C@@]1(n2ccc(=O)[nH]c2=O)O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H16N2O7/c1-2-7(16)12(10(19)9(18)6(5-15)21-12)14-4-3-8(17)13-11(14)20/h3-4,6,9-10,15,18-19H,2,5H2,1H3,(H,13,17,20)/t6-,9-,10-,12-/m1/s1 |
| InChIKey | HMTUWGXIQRRCMG-XYHAGOFUSA-N |
| XLogP | -2.72 |
| TPSA | 141.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |