C20H31F3N2O7 — CID 67708641
1-[(2R,3R,4R,5R)-2-decoxy-3,4-dihydroxy-5-(hydroxymethyl)-3-(trifluoromethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 67708641) has the molecular formula C20H31F3N2O7 and a molecular weight of 468.47 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-2-decoxy-3,4-dihydroxy-5-(hydroxymethyl)-3-(trifluoromethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-2-decoxy-3,4-dihydroxy-5-(hydroxymethyl)-3-(trifluoromethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67708641 |
| Molecular Formula | C20H31F3N2O7 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-2-decoxy-3,4-dihydroxy-5-(hydroxymethyl)-3-(trifluoromethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCCCCCCCCCO[C@@]1(n2ccc(=O)[nH]c2=O)O[C@H](CO)[C@@H](O)[C@]1(O)C(F)(F)F |
| InChI | InChI=1S/C20H31F3N2O7/c1-2-3-4-5-6-7-8-9-12-31-20(25-11-10-15(27)24-17(25)29)18(30,19(21,22)23)16(28)14(13-26)32-20/h10-11,14,16,26,28,30H,2-9,12-13H2,1H3,(H,24,27,29)/t14-,16-,18+,20-/m1/s1 |
| InChIKey | PSDJDUHUDKIPOO-GNUPYSACSA-N |
| XLogP | 1.35 |
| TPSA | 134.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|