C12H18F3N4O9P — CID 159073660
aminophosphonous acid;N-[(2R,3R,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-5-(hydroxymethyl)-2-methyloxolan-3-yl]-2,2,2-trifluoroacetamide (PubChem CID 159073660) has the molecular formula C12H18F3N4O9P and a molecular weight of 450.26 g/mol. Its IUPAC name is aminophosphonous acid;N-[(2R,3R,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-5-(hydroxymethyl)-2-methyloxolan-3-yl]-2,2,2-trifluoroacetamide.
| Compound Name | aminophosphonous acid;N-[(2R,3R,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-5-(hydroxymethyl)-2-methyloxolan-3-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 159073660 |
| Molecular Formula | C12H18F3N4O9P |
| Molecular Weight | 450.26 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | aminophosphonous acid;N-[(2R,3R,4R,5R)-2-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-5-(hydroxymethyl)-2-methyloxolan-3-yl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@@]1(n2ccc(=O)[nH]c2=O)O[C@H](CO)[C@@H](O)[C@]1(O)NC(=O)C(F)(F)F.NP(O)O |
| InChI | InChI=1S/C12H14F3N3O7.H4NO2P/c1-10(18-3-2-6(20)16-9(18)23)11(24,7(21)5(4-19)25-10)17-8(22)12(13,14)15;1-4(2)3/h2-3,5,7,19,21,24H,4H2,1H3,(H,17,22)(H,16,20,23);2-3H,1H2/t5-,7-,10-,11-;/m1./s1 |
| InChIKey | JZZAXVCQVWGSTK-GGOVXXQRSA-N |
| XLogP | -3.52 |
| TPSA | 220.36 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.26 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|