C29H28N2O7 — CID 154452202
1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methoxy-2-trityloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 154452202) has the molecular formula C29H28N2O7 and a molecular weight of 516.55 g/mol. Its IUPAC name is 1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methoxy-2-trityloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methoxy-2-trityloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 154452202 |
| Molecular Formula | C29H28N2O7 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 1-[(2R,3S,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methoxy-2-trityloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CO[C@@]1(O)[C@H](O)[C@@H](CO)O[C@]1(n1ccc(=O)[nH]c1=O)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H28N2O7/c1-37-28(36)25(34)23(19-32)38-29(28,31-18-17-24(33)30-26(31)35)27(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-18,23,25,32,34,36H,19H2,1H3,(H,30,33,35)/t23-,25-,28+,29-/m1/s1 |
| InChIKey | BAVZSLQQXRYISX-ADTKTOCISA-N |
| XLogP | 1.31 |
| TPSA | 134.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|