C30H31N3O6 — CID 67768360
4-amino-1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3,3-dimethoxy-2-trityloxolan-2-yl]pyrimidin-2-one (PubChem CID 67768360) has the molecular formula C30H31N3O6 and a molecular weight of 529.59 g/mol. Its IUPAC name is 4-amino-1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3,3-dimethoxy-2-trityloxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3,3-dimethoxy-2-trityloxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 67768360 |
| Molecular Formula | C30H31N3O6 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | 4-amino-1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3,3-dimethoxy-2-trityloxolan-2-yl]pyrimidin-2-one |
| SMILES | COC1(OC)[C@H](O)[C@@H](CO)O[C@]1(n1ccc(N)nc1=O)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H31N3O6/c1-37-29(38-2)26(35)24(20-34)39-30(29,33-19-18-25(31)32-27(33)36)28(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-19,24,26,34-35H,20H2,1-2H3,(H2,31,32,36)/t24-,26-,30-/m1/s1 |
| InChIKey | IHJBDPILDXTHTI-DHDFKREGSA-N |
| XLogP | 2.25 |
| TPSA | 129.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|