C30H31N3O9P+ — CID 67421892
[(2R,3R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-5-[bis(4-methoxyphenyl)-phenylmethyl]-3-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxy-oxophosphanium (PubChem CID 67421892) has the molecular formula C30H31N3O9P+ and a molecular weight of 608.56 g/mol. Its IUPAC name is [(2R,3R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-5-[bis(4-methoxyphenyl)-phenylmethyl]-3-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxy-oxophosphanium.
| Compound Name | [(2R,3R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-5-[bis(4-methoxyphenyl)-phenylmethyl]-3-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 67421892 |
| Molecular Formula | C30H31N3O9P+ |
| Molecular Weight | 608.56 g/mol |
| Exact Mass | 608.18 |
| IUPAC Name | [(2R,3R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-5-[bis(4-methoxyphenyl)-phenylmethyl]-3-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxy-oxophosphanium |
| SMILES | COc1ccc(C(c2ccccc2)(c2ccc(OC)cc2)[C@]2(n3ccc(N)nc3=O)C[C@@](O)(O[P+](=O)O)[C@@H](CO)O2)cc1 |
| InChI | InChI=1S/C30H30N3O9P/c1-39-23-12-8-21(9-13-23)30(20-6-4-3-5-7-20,22-10-14-24(40-2)15-11-22)29(33-17-16-26(31)32-27(33)35)19-28(36,42-43(37)38)25(18-34)41-29/h3-17,25,34,36H,18-19H2,1-2H3,(H2-,31,32,35,37,38)/p+1/t25-,28-,29+/m1/s1 |
| InChIKey | WTSDCKXLSFILRX-ZJGIAAPESA-O |
| XLogP | 2.67 |
| TPSA | 175.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.56 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|