C26H27FO5 — CID 57184983
(2R,3R,4S)-4-[bis(4-methoxyphenyl)-phenylmethyl]-4-fluoro-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 57184983) has the molecular formula C26H27FO5 and a molecular weight of 438.50 g/mol. Its IUPAC name is (2R,3R,4S)-4-[bis(4-methoxyphenyl)-phenylmethyl]-4-fluoro-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,4S)-4-[bis(4-methoxyphenyl)-phenylmethyl]-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 57184983 |
| Molecular Formula | C26H27FO5 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | (2R,3R,4S)-4-[bis(4-methoxyphenyl)-phenylmethyl]-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | COc1ccc(C(c2ccccc2)(c2ccc(OC)cc2)[C@]2(F)CO[C@H](CO)[C@H]2O)cc1 |
| InChI | InChI=1S/C26H27FO5/c1-30-21-12-8-19(9-13-21)26(18-6-4-3-5-7-18,20-10-14-22(31-2)15-11-20)25(27)17-32-23(16-28)24(25)29/h3-15,23-24,28-29H,16-17H2,1-2H3/t23-,24-,25+/m1/s1 |
| InChIKey | FRXBUZQJKDSYAF-SDHSZQHLSA-N |
| XLogP | 3.50 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|