C30H29IN2O8 — CID 70300371
1-[(2R,3R,4S,5R)-2-[bis(4-methoxyphenyl)-phenylmethyl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione (PubChem CID 70300371) has the molecular formula C30H29IN2O8 and a molecular weight of 672.47 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-2-[bis(4-methoxyphenyl)-phenylmethyl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-2-[bis(4-methoxyphenyl)-phenylmethyl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70300371 |
| Molecular Formula | C30H29IN2O8 |
| Molecular Weight | 672.47 g/mol |
| Exact Mass | 672.10 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-2-[bis(4-methoxyphenyl)-phenylmethyl]-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione |
| SMILES | COc1ccc(C(c2ccccc2)(c2ccc(OC)cc2)[C@@]2(n3cc(I)c(=O)[nH]c3=O)O[C@H](CO)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C30H29IN2O8/c1-39-21-12-8-19(9-13-21)29(18-6-4-3-5-7-18,20-10-14-22(40-2)15-11-20)30(26(36)25(35)24(17-34)41-30)33-16-23(31)27(37)32-28(33)38/h3-16,24-26,34-36H,17H2,1-2H3,(H,32,37,38)/t24-,25-,26-,30+/m1/s1 |
| InChIKey | ZEALSQMAUIMWRA-JALVRWGXSA-N |
| XLogP | 1.96 |
| TPSA | 143.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|