C12H16N2O9 — CID 89486812
methyl 1-[(2R,3R,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidine-5-carboxylate (PubChem CID 89486812) has the molecular formula C12H16N2O9 and a molecular weight of 332.27 g/mol. Its IUPAC name is methyl 1-[(2R,3R,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidine-5-carboxylate.
| Compound Name | methyl 1-[(2R,3R,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 89486812 |
| Molecular Formula | C12H16N2O9 |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | methyl 1-[(2R,3R,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidine-5-carboxylate |
| SMILES | COC(=O)c1cn([C@]2(CO)O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H16N2O9/c1-22-10(20)5-2-14(11(21)13-9(5)19)12(4-16)8(18)7(17)6(3-15)23-12/h2,6-8,15-18H,3-4H2,1H3,(H,13,19,21)/t6-,7-,8-,12-/m1/s1 |
| InChIKey | JVGMKKCAGNGVLA-BMYQGPEFSA-N |
| XLogP | -3.92 |
| TPSA | 171.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | -3.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |