C13H20N2O8 — CID 166771906
1-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-(1-methoxyethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 166771906) has the molecular formula C13H20N2O8 and a molecular weight of 332.31 g/mol. Its IUPAC name is 1-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-(1-methoxyethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-(1-methoxyethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 166771906 |
| Molecular Formula | C13H20N2O8 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 1-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-(1-methoxyethoxy)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | COC(C)O[C@@]1(n2cc(C)c(=O)[nH]c2=O)O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H20N2O8/c1-6-4-15(12(20)14-11(6)19)13(22-7(2)21-3)10(18)9(17)8(5-16)23-13/h4,7-10,16-18H,5H2,1-3H3,(H,14,19,20)/t7?,8-,9-,10-,13-/m1/s1 |
| InChIKey | RKCVDASKBUHVPM-HDKLIBPASA-N |
| XLogP | -2.42 |
| TPSA | 143.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|