C16H28N2O6Si — CID 154143591
1-[(2S,3R,4S,5R)-2-dimethylsilyl-3,4-dihydroxy-5-[(2-methylpropan-2-yl)oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 154143591) has the molecular formula C16H28N2O6Si and a molecular weight of 372.49 g/mol. Its IUPAC name is 1-[(2S,3R,4S,5R)-2-dimethylsilyl-3,4-dihydroxy-5-[(2-methylpropan-2-yl)oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2S,3R,4S,5R)-2-dimethylsilyl-3,4-dihydroxy-5-[(2-methylpropan-2-yl)oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 154143591 |
| Molecular Formula | C16H28N2O6Si |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 1-[(2S,3R,4S,5R)-2-dimethylsilyl-3,4-dihydroxy-5-[(2-methylpropan-2-yl)oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@]2([SiH](C)C)O[C@H](COC(C)(C)C)[C@@H](O)[C@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H28N2O6Si/c1-9-7-18(14(22)17-13(9)21)16(25(5)6)12(20)11(19)10(24-16)8-23-15(2,3)4/h7,10-12,19-20,25H,8H2,1-6H3,(H,17,21,22)/t10-,11-,12-,16+/m1/s1 |
| InChIKey | ISSPLPPXSXOJBM-QHSOUUPTSA-N |
| XLogP | -0.54 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|