C36H44N2O8Si — CID 173209086
1-[(2S,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-dimethylsilyl-4-hydroxy-3-[(2-methylpropan-2-yl)oxy]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 173209086) has the molecular formula C36H44N2O8Si and a molecular weight of 660.84 g/mol. Its IUPAC name is 1-[(2S,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-dimethylsilyl-4-hydroxy-3-[(2-methylpropan-2-yl)oxy]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2S,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-dimethylsilyl-4-hydroxy-3-[(2-methylpropan-2-yl)oxy]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 173209086 |
| Molecular Formula | C36H44N2O8Si |
| Molecular Weight | 660.84 g/mol |
| Exact Mass | 660.29 |
| IUPAC Name | 1-[(2S,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-2-dimethylsilyl-4-hydroxy-3-[(2-methylpropan-2-yl)oxy]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(OC[C@H]2O[C@](n3ccc(=O)[nH]c3=O)([SiH](C)C)[C@H](OC(C)(C)C)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C36H44N2O8Si/c1-34(2,3)46-32-31(40)29(45-36(32,47(6)7)38-22-21-30(39)37-33(38)41)23-44-35(24-11-9-8-10-12-24,25-13-17-27(42-4)18-14-25)26-15-19-28(43-5)20-16-26/h8-22,29,31-32,40,47H,23H2,1-7H3,(H,37,39,41)/t29-,31-,32-,36+/m1/s1 |
| InChIKey | ZKGXLLNSGZZXGK-RZPUDJTGSA-N |
| XLogP | 4.18 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.84 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|