C36H43N3O8 — CID 18345915
1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(hexylamino)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 18345915) has the molecular formula C36H43N3O8 and a molecular weight of 645.75 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(hexylamino)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(hexylamino)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 18345915 |
| Molecular Formula | C36H43N3O8 |
| Molecular Weight | 645.75 g/mol |
| Exact Mass | 645.31 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-(hexylamino)-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CCCCCCN[C@@]1(O)[C@H](O)[C@@H](COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C36H43N3O8/c1-4-5-6-10-22-37-36(43)32(41)30(47-33(36)39-23-21-31(40)38-34(39)42)24-46-35(25-11-8-7-9-12-25,26-13-17-28(44-2)18-14-26)27-15-19-29(45-3)20-16-27/h7-9,11-21,23,30,32-33,37,41,43H,4-6,10,22,24H2,1-3H3,(H,38,40,42)/t30-,32-,33-,36-/m1/s1 |
| InChIKey | JYUBEJFTJOCEKG-QGGAYTEESA-N |
| XLogP | 3.68 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.75 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|