C12H20N2O5Si — CID 174922887
1-[(2S,4S,5R)-2-dimethylsilyl-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 174922887) has the molecular formula C12H20N2O5Si and a molecular weight of 300.39 g/mol. Its IUPAC name is 1-[(2S,4S,5R)-2-dimethylsilyl-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2S,4S,5R)-2-dimethylsilyl-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 174922887 |
| Molecular Formula | C12H20N2O5Si |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 1-[(2S,4S,5R)-2-dimethylsilyl-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@]2([SiH](C)C)C[C@H](O)[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H20N2O5Si/c1-7-5-14(11(18)13-10(7)17)12(20(2)3)4-8(16)9(6-15)19-12/h5,8-9,15-16,20H,4,6H2,1-3H3,(H,13,17,18)/t8-,9+,12-/m0/s1 |
| InChIKey | DVGRULRIOQPUDA-SBMIAAHKSA-N |
| XLogP | -1.33 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|