C15H23FN2O5 — CID 69162826
1-[(2R,4S,5R)-2-(5-fluoropentyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 69162826) has the molecular formula C15H23FN2O5 and a molecular weight of 330.36 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-2-(5-fluoropentyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-2-(5-fluoropentyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 69162826 |
| Molecular Formula | C15H23FN2O5 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-[(2R,4S,5R)-2-(5-fluoropentyl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@]2(CCCCCF)C[C@H](O)[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H23FN2O5/c1-10-8-18(14(22)17-13(10)21)15(5-3-2-4-6-16)7-11(20)12(9-19)23-15/h8,11-12,19-20H,2-7,9H2,1H3,(H,17,21,22)/t11-,12+,15+/m0/s1 |
| InChIKey | KMIMGNATQNROCU-YWPYICTPSA-N |
| XLogP | 0.17 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|