C11H13N5O6 — CID 154167761
(2S,4S,5S)-4-azido-5-(hydroxymethyl)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-2-carboxylic acid (PubChem CID 154167761) has the molecular formula C11H13N5O6 and a molecular weight of 311.25 g/mol. Its IUPAC name is (2S,4S,5S)-4-azido-5-(hydroxymethyl)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-2-carboxylic acid.
| Compound Name | (2S,4S,5S)-4-azido-5-(hydroxymethyl)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 154167761 |
| Molecular Formula | C11H13N5O6 |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | (2S,4S,5S)-4-azido-5-(hydroxymethyl)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-2-carboxylic acid |
| SMILES | Cc1cn([C@@]2(C(=O)O)C[C@H](N=[N+]=[N-])[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H13N5O6/c1-5-3-16(10(21)13-8(5)18)11(9(19)20)2-6(14-15-12)7(4-17)22-11/h3,6-7,17H,2,4H2,1H3,(H,19,20)(H,13,18,21)/t6-,7+,11-/m0/s1 |
| InChIKey | OYEWYBHHEPLOBZ-CVJICSNFSA-N |
| XLogP | -0.96 |
| TPSA | 170.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|