C26H30BrFN2O5Si — CID 173401883
1-[(2S,3R,4R,5R)-3-bromo-2-diphenylsilyl-4-hydroxy-5-[(2-methylpropan-2-yl)oxymethyl]oxolan-2-yl]-5-(fluoromethyl)pyrimidine-2,4-dione (PubChem CID 173401883) has the molecular formula C26H30BrFN2O5Si and a molecular weight of 577.52 g/mol. Its IUPAC name is 1-[(2S,3R,4R,5R)-3-bromo-2-diphenylsilyl-4-hydroxy-5-[(2-methylpropan-2-yl)oxymethyl]oxolan-2-yl]-5-(fluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2S,3R,4R,5R)-3-bromo-2-diphenylsilyl-4-hydroxy-5-[(2-methylpropan-2-yl)oxymethyl]oxolan-2-yl]-5-(fluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 173401883 |
| Molecular Formula | C26H30BrFN2O5Si |
| Molecular Weight | 577.52 g/mol |
| Exact Mass | 576.11 |
| IUPAC Name | 1-[(2S,3R,4R,5R)-3-bromo-2-diphenylsilyl-4-hydroxy-5-[(2-methylpropan-2-yl)oxymethyl]oxolan-2-yl]-5-(fluoromethyl)pyrimidine-2,4-dione |
| SMILES | CC(C)(C)OC[C@H]1O[C@](n2cc(CF)c(=O)[nH]c2=O)([SiH](c2ccccc2)c2ccccc2)[C@H](Br)[C@@H]1O |
| InChI | InChI=1S/C26H30BrFN2O5Si/c1-25(2,3)34-16-20-21(31)22(27)26(35-20,30-15-17(14-28)23(32)29-24(30)33)36(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13,15,20-22,31,36H,14,16H2,1-3H3,(H,29,32,33)/t20-,21-,22-,26+/m1/s1 |
| InChIKey | YAYCUYHMMBRDPN-BILGYAHESA-N |
| XLogP | 1.58 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.52 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|