C26H30ClFN2O5Si — CID 22839277
1-[(2R,3R,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-chloro-4-hydroxyoxolan-2-yl]-5-(fluoromethyl)pyrimidine-2,4-dione (PubChem CID 22839277) has the molecular formula C26H30ClFN2O5Si and a molecular weight of 533.07 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-chloro-4-hydroxyoxolan-2-yl]-5-(fluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-chloro-4-hydroxyoxolan-2-yl]-5-(fluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 22839277 |
| Molecular Formula | C26H30ClFN2O5Si |
| Molecular Weight | 533.07 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-chloro-4-hydroxyoxolan-2-yl]-5-(fluoromethyl)pyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@@H](n2cc(CF)c(=O)[nH]c2=O)[C@H](Cl)[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H30ClFN2O5Si/c1-26(2,3)36(18-10-6-4-7-11-18,19-12-8-5-9-13-19)34-16-20-22(31)21(27)24(35-20)30-15-17(14-28)23(32)29-25(30)33/h4-13,15,20-22,24,31H,14,16H2,1-3H3,(H,29,32,33)/t20-,21-,22-,24-/m1/s1 |
| InChIKey | LCNFVPGVPGEZLA-GBEXAXCTSA-N |
| XLogP | 2.45 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.07 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|