C25H29FN2O4Si — CID 14796830
1-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxycyclobutyl]-5-fluoropyrimidine-2,4-dione (PubChem CID 14796830) has the molecular formula C25H29FN2O4Si and a molecular weight of 468.60 g/mol. Its IUPAC name is 1-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxycyclobutyl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxycyclobutyl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 14796830 |
| Molecular Formula | C25H29FN2O4Si |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 1-[3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-hydroxycyclobutyl]-5-fluoropyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](OCC1CC(n2cc(F)c(=O)[nH]c2=O)C1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H29FN2O4Si/c1-25(2,3)33(18-10-6-4-7-11-18,19-12-8-5-9-13-19)32-16-17-14-21(22(17)29)28-15-20(26)23(30)27-24(28)31/h4-13,15,17,21-22,29H,14,16H2,1-3H3,(H,27,30,31) |
| InChIKey | NJIWHXBFDUJHQF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|