C25H33FN4O7 — CID 110153998
tert-butyl N-[3-[benzyl-[[(1S,2R,3R,4R)-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2,3-dihydroxycyclopentyl]methyl]amino]-3-oxopropyl]carbamate (PubChem CID 110153998) has the molecular formula C25H33FN4O7 and a molecular weight of 520.56 g/mol. Its IUPAC name is tert-butyl N-[3-[benzyl-[[(1S,2R,3R,4R)-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2,3-dihydroxycyclopentyl]methyl]amino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[benzyl-[[(1S,2R,3R,4R)-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2,3-dihydroxycyclopentyl]methyl]amino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 110153998 |
| Molecular Formula | C25H33FN4O7 |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | tert-butyl N-[3-[benzyl-[[(1S,2R,3R,4R)-4-(5-fluoro-2,4-dioxopyrimidin-1-yl)-2,3-dihydroxycyclopentyl]methyl]amino]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)N(Cc1ccccc1)C[C@@H]1C[C@@H](n2cc(F)c(=O)[nH]c2=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H33FN4O7/c1-25(2,3)37-24(36)27-10-9-19(31)29(12-15-7-5-4-6-8-15)13-16-11-18(21(33)20(16)32)30-14-17(26)22(34)28-23(30)35/h4-8,14,16,18,20-21,32-33H,9-13H2,1-3H3,(H,27,36)(H,28,34,35)/t16-,18+,20+,21+/m0/s1 |
| InChIKey | QKBGQSRGIFRYES-RCVZYCBYSA-N |
| XLogP | 0.90 |
| TPSA | 153.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |