C22H27N3O7 — CID 110154582
5-[benzyl-[[(1S,2R,3R,4S)-3-(2,4-dioxopyrimidin-1-yl)-2,4-dihydroxycyclopentyl]methyl]amino]-5-oxopentanoic acid (PubChem CID 110154582) has the molecular formula C22H27N3O7 and a molecular weight of 445.47 g/mol. Its IUPAC name is 5-[benzyl-[[(1S,2R,3R,4S)-3-(2,4-dioxopyrimidin-1-yl)-2,4-dihydroxycyclopentyl]methyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-[benzyl-[[(1S,2R,3R,4S)-3-(2,4-dioxopyrimidin-1-yl)-2,4-dihydroxycyclopentyl]methyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 110154582 |
| Molecular Formula | C22H27N3O7 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 5-[benzyl-[[(1S,2R,3R,4S)-3-(2,4-dioxopyrimidin-1-yl)-2,4-dihydroxycyclopentyl]methyl]amino]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)N(Cc1ccccc1)C[C@@H]1C[C@H](O)[C@@H](n2ccc(=O)[nH]c2=O)[C@@H]1O |
| InChI | InChI=1S/C22H27N3O7/c26-16-11-15(21(31)20(16)25-10-9-17(27)23-22(25)32)13-24(12-14-5-2-1-3-6-14)18(28)7-4-8-19(29)30/h1-3,5-6,9-10,15-16,20-21,26,31H,4,7-8,11-13H2,(H,29,30)(H,23,27,32)/t15-,16-,20+,21+/m0/s1 |
| InChIKey | XJRZSUVLCSWPSN-LVNJIZSUSA-N |
| XLogP | 0.10 |
| TPSA | 152.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |