C10H13FN2O5 — CID 153342155
1-[(1R,2S,3S,4S)-4-fluoro-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]pyrimidine-2,4-dione (PubChem CID 153342155) has the molecular formula C10H13FN2O5 and a molecular weight of 260.22 g/mol. Its IUPAC name is 1-[(1R,2S,3S,4S)-4-fluoro-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1R,2S,3S,4S)-4-fluoro-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 153342155 |
| Molecular Formula | C10H13FN2O5 |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1-[(1R,2S,3S,4S)-4-fluoro-2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@@H]2C[C@](F)(CO)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C10H13FN2O5/c11-10(4-14)3-5(7(16)8(10)17)13-2-1-6(15)12-9(13)18/h1-2,5,7-8,14,16-17H,3-4H2,(H,12,15,18)/t5-,7+,8+,10+/m1/s1 |
| InChIKey | MRUFBEHAKAQUNV-CERHOOOWSA-N |
| XLogP | -2.10 |
| TPSA | 115.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |