C9H11FN2O4 — CID 18783254
1-[4-fluoro-4-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 18783254) has the molecular formula C9H11FN2O4 and a molecular weight of 230.19 g/mol. Its IUPAC name is 1-[4-fluoro-4-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[4-fluoro-4-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 18783254 |
| Molecular Formula | C9H11FN2O4 |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 1-[4-fluoro-4-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn(C2CC(F)(CO)CO2)c(=O)[nH]1 |
| InChI | InChI=1S/C9H11FN2O4/c10-9(4-13)3-7(16-5-9)12-2-1-6(14)11-8(12)15/h1-2,7,13H,3-5H2,(H,11,14,15) |
| InChIKey | YUFIYNZWUKMCQR-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |