C13H16FIN2O4 — CID 160933970
1-[(3aS,4R,6R,6aS)-4-fluoro-4-(iodomethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-yl]pyrimidine-2,4-dione (PubChem CID 160933970) has the molecular formula C13H16FIN2O4 and a molecular weight of 410.18 g/mol. Its IUPAC name is 1-[(3aS,4R,6R,6aS)-4-fluoro-4-(iodomethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(3aS,4R,6R,6aS)-4-fluoro-4-(iodomethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 160933970 |
| Molecular Formula | C13H16FIN2O4 |
| Molecular Weight | 410.18 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | 1-[(3aS,4R,6R,6aS)-4-fluoro-4-(iodomethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-yl]pyrimidine-2,4-dione |
| SMILES | CC1(C)O[C@H]2[C@H](n3ccc(=O)[nH]c3=O)C[C@](F)(CI)[C@H]2O1 |
| InChI | InChI=1S/C13H16FIN2O4/c1-12(2)20-9-7(5-13(14,6-15)10(9)21-12)17-4-3-8(18)16-11(17)19/h3-4,7,9-10H,5-6H2,1-2H3,(H,16,18,19)/t7-,9+,10+,13+/m1/s1 |
| InChIKey | GJQQAHKZWCAVDC-BDXNGKNPSA-N |
| XLogP | 1.14 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.18 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|