C12H16N2O5 — CID 89495296
1-[(4S,6R)-4-hydroxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]pyrimidine-2,4-dione (PubChem CID 89495296) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is 1-[(4S,6R)-4-hydroxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(4S,6R)-4-hydroxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 89495296 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1-[(4S,6R)-4-hydroxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]pyrimidine-2,4-dione |
| SMILES | CC1(C)OC2C(O1)[C@@H](O)C[C@H]2n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C12H16N2O5/c1-12(2)18-9-6(5-7(15)10(9)19-12)14-4-3-8(16)13-11(14)17/h3-4,6-7,9-10,15H,5H2,1-2H3,(H,13,16,17)/t6-,7+,9?,10?/m1/s1 |
| InChIKey | MAGNUBNXNZVGMT-RHRMWPKMSA-N |
| XLogP | -0.64 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |