C13H17N2O8P-2 — CID 140695957
1-[(4S,6R)-2,2-dimethyl-4-(phosphonatomethoxy)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]pyrimidine-2,4-dione (PubChem CID 140695957) has the molecular formula C13H17N2O8P-2 and a molecular weight of 360.26 g/mol. Its IUPAC name is 1-[(4S,6R)-2,2-dimethyl-4-(phosphonatomethoxy)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(4S,6R)-2,2-dimethyl-4-(phosphonatomethoxy)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 140695957 |
| Molecular Formula | C13H17N2O8P-2 |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 1-[(4S,6R)-2,2-dimethyl-4-(phosphonatomethoxy)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]pyrimidine-2,4-dione |
| SMILES | CC1(C)OC2C(O1)[C@H](n1ccc(=O)[nH]c1=O)C[C@@H]2OCP(=O)([O-])[O-] |
| InChI | InChI=1S/C13H19N2O8P/c1-13(2)22-10-7(15-4-3-9(16)14-12(15)17)5-8(11(10)23-13)21-6-24(18,19)20/h3-4,7-8,10-11H,5-6H2,1-2H3,(H,14,16,17)(H2,18,19,20)/p-2/t7-,8+,10?,11?/m1/s1 |
| InChIKey | FBXATVXXJVTILS-NOFHBMEESA-L |
| XLogP | -1.74 |
| TPSA | 145.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|