C11H17N2O6P — CID 101180478
[(1S,2S)-2-(2,4-dioxopyrimidin-1-yl)cyclohexyl]oxymethylphosphonic acid (PubChem CID 101180478) has the molecular formula C11H17N2O6P and a molecular weight of 304.24 g/mol. Its IUPAC name is [(1S,2S)-2-(2,4-dioxopyrimidin-1-yl)cyclohexyl]oxymethylphosphonic acid.
| Compound Name | [(1S,2S)-2-(2,4-dioxopyrimidin-1-yl)cyclohexyl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 101180478 |
| Molecular Formula | C11H17N2O6P |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | [(1S,2S)-2-(2,4-dioxopyrimidin-1-yl)cyclohexyl]oxymethylphosphonic acid |
| SMILES | O=c1ccn([C@H]2CCCC[C@@H]2OCP(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C11H17N2O6P/c14-10-5-6-13(11(15)12-10)8-3-1-2-4-9(8)19-7-20(16,17)18/h5-6,8-9H,1-4,7H2,(H,12,14,15)(H2,16,17,18)/t8-,9-/m0/s1 |
| InChIKey | HCVYZHXEBOETOO-IUCAKERBSA-N |
| XLogP | 0.17 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|