C16H17N2O9P — CID 90696831
[(2R,4R,5R)-4-benzoyloxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]oxymethylphosphonic acid (PubChem CID 90696831) has the molecular formula C16H17N2O9P and a molecular weight of 412.29 g/mol. Its IUPAC name is [(2R,4R,5R)-4-benzoyloxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]oxymethylphosphonic acid.
| Compound Name | [(2R,4R,5R)-4-benzoyloxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 90696831 |
| Molecular Formula | C16H17N2O9P |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | [(2R,4R,5R)-4-benzoyloxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]oxymethylphosphonic acid |
| SMILES | O=C(O[C@@H]1C[C@@H](OCP(=O)(O)O)O[C@H]1n1ccc(=O)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C16H17N2O9P/c19-12-6-7-18(16(21)17-12)14-11(8-13(27-14)25-9-28(22,23)24)26-15(20)10-4-2-1-3-5-10/h1-7,11,13-14H,8-9H2,(H,17,19,21)(H2,22,23,24)/t11-,13+,14-/m1/s1 |
| InChIKey | RIHBZMMMZZKAEP-KWCYVHTRSA-N |
| XLogP | 0.16 |
| TPSA | 157.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|