C20H23N2O8P — CID 138530228
[2-[(E)-2-dimethoxyphosphorylethenyl]-6-(2,4-dioxopyrimidin-1-yl)oxan-3-yl] benzoate (PubChem CID 138530228) has the molecular formula C20H23N2O8P and a molecular weight of 450.38 g/mol. Its IUPAC name is [2-[(E)-2-dimethoxyphosphorylethenyl]-6-(2,4-dioxopyrimidin-1-yl)oxan-3-yl] benzoate.
| Compound Name | [2-[(E)-2-dimethoxyphosphorylethenyl]-6-(2,4-dioxopyrimidin-1-yl)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 138530228 |
| Molecular Formula | C20H23N2O8P |
| Molecular Weight | 450.38 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | [2-[(E)-2-dimethoxyphosphorylethenyl]-6-(2,4-dioxopyrimidin-1-yl)oxan-3-yl] benzoate |
| SMILES | COP(=O)(/C=C/C1OC(n2ccc(=O)[nH]c2=O)CCC1OC(=O)c1ccccc1)OC |
| InChI | InChI=1S/C20H23N2O8P/c1-27-31(26,28-2)13-11-16-15(30-19(24)14-6-4-3-5-7-14)8-9-18(29-16)22-12-10-17(23)21-20(22)25/h3-7,10-13,15-16,18H,8-9H2,1-2H3,(H,21,23,25)/b13-11+ |
| InChIKey | UYYRZBSCESQONR-ACCUITESSA-N |
| XLogP | 2.44 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|