C12H18N2O6P+ — CID 142554941
[(E)-2-[5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]ethenyl]-hydroxy-dimethoxyphosphanium (PubChem CID 142554941) has the molecular formula C12H18N2O6P+ and a molecular weight of 317.26 g/mol. Its IUPAC name is [(E)-2-[5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]ethenyl]-hydroxy-dimethoxyphosphanium.
| Compound Name | [(E)-2-[5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]ethenyl]-hydroxy-dimethoxyphosphanium |
|---|---|
| PubChem CID | 142554941 |
| Molecular Formula | C12H18N2O6P+ |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | [(E)-2-[5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]ethenyl]-hydroxy-dimethoxyphosphanium |
| SMILES | CO[P+](O)(/C=C/C1CCC(n2ccc(=O)[nH]c2=O)O1)OC |
| InChI | InChI=1S/C12H17N2O6P/c1-18-21(17,19-2)8-6-9-3-4-11(20-9)14-7-5-10(15)13-12(14)16/h5-9,11,17H,3-4H2,1-2H3/p+1/b8-6+ |
| InChIKey | UXYPRIZDIYYZOZ-SOFGYWHQSA-O |
| XLogP | 0.78 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|