C13H20N3O5P — CID 142619500
1-[7-[(E)-2-dimethoxyphosphanylethenyl]-1,4-oxazepan-2-yl]pyrimidine-2,4-dione (PubChem CID 142619500) has the molecular formula C13H20N3O5P and a molecular weight of 329.29 g/mol. Its IUPAC name is 1-[7-[(E)-2-dimethoxyphosphanylethenyl]-1,4-oxazepan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[7-[(E)-2-dimethoxyphosphanylethenyl]-1,4-oxazepan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142619500 |
| Molecular Formula | C13H20N3O5P |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 1-[7-[(E)-2-dimethoxyphosphanylethenyl]-1,4-oxazepan-2-yl]pyrimidine-2,4-dione |
| SMILES | COP(/C=C/C1CCNCC(n2ccc(=O)[nH]c2=O)O1)OC |
| InChI | InChI=1S/C13H20N3O5P/c1-19-22(20-2)8-5-10-3-6-14-9-12(21-10)16-7-4-11(17)15-13(16)18/h4-5,7-8,10,12,14H,3,6,9H2,1-2H3,(H,15,17,18)/b8-5+ |
| InChIKey | AGASHZQBAPRQMH-VMPITWQZSA-N |
| XLogP | 0.53 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|