C18H36N3O5P — CID 143089389
ethane;methoxy-N,N-di(propan-2-yl)phosphonamidous acid;1-(5-methyloxolan-2-yl)pyrimidine-2,4-dione (PubChem CID 143089389) has the molecular formula C18H36N3O5P and a molecular weight of 405.48 g/mol. Its IUPAC name is ethane;methoxy-N,N-di(propan-2-yl)phosphonamidous acid;1-(5-methyloxolan-2-yl)pyrimidine-2,4-dione.
| Compound Name | ethane;methoxy-N,N-di(propan-2-yl)phosphonamidous acid;1-(5-methyloxolan-2-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 143089389 |
| Molecular Formula | C18H36N3O5P |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | ethane;methoxy-N,N-di(propan-2-yl)phosphonamidous acid;1-(5-methyloxolan-2-yl)pyrimidine-2,4-dione |
| SMILES | CC.CC1CCC(n2ccc(=O)[nH]c2=O)O1.COP(O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C9H12N2O3.C7H18NO2P.C2H6/c1-6-2-3-8(14-6)11-5-4-7(12)10-9(11)13;1-6(2)8(7(3)4)11(9)10-5;1-2/h4-6,8H,2-3H2,1H3,(H,10,12,13);6-7,9H,1-5H3;1-2H3 |
| InChIKey | ZQEPORCMXLLHOA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|