C12H18N3O4P — CID 157385494
1-[6-[(E)-2-dimethylphosphorylethenyl]morpholin-2-yl]pyrimidine-2,4-dione (PubChem CID 157385494) has the molecular formula C12H18N3O4P and a molecular weight of 299.27 g/mol. Its IUPAC name is 1-[6-[(E)-2-dimethylphosphorylethenyl]morpholin-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[6-[(E)-2-dimethylphosphorylethenyl]morpholin-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 157385494 |
| Molecular Formula | C12H18N3O4P |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-[6-[(E)-2-dimethylphosphorylethenyl]morpholin-2-yl]pyrimidine-2,4-dione |
| SMILES | CP(C)(=O)/C=C/C1CNCC(n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C12H18N3O4P/c1-20(2,18)6-4-9-7-13-8-11(19-9)15-5-3-10(16)14-12(15)17/h3-6,9,11,13H,7-8H2,1-2H3,(H,14,16,17)/b6-4+ |
| InChIKey | OIXQZZFOEVJYCV-GQCTYLIASA-N |
| XLogP | 0.16 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|