C9H10N2O3 — CID 22855921
1-[(2R)-5-methylideneoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 22855921) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is 1-[(2R)-5-methylideneoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R)-5-methylideneoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 22855921 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 1-[(2R)-5-methylideneoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C=C1CC[C@H](n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C9H10N2O3/c1-6-2-3-8(14-6)11-5-4-7(12)10-9(11)13/h4-5,8H,1-3H2,(H,10,12,13)/t8-/m1/s1 |
| InChIKey | MIOGWNMZXKUCDB-MRVPVSSYSA-N |
| XLogP | 0.36 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |