C16H23F3N3O6P — CID 142619507
1-[6-[(E)-2-dimethoxyphosphanylethenyl]-4-(2,2,2-trifluoroacetyl)morpholin-2-yl]pyrimidine-2,4-dione;ethane (PubChem CID 142619507) has the molecular formula C16H23F3N3O6P and a molecular weight of 441.34 g/mol. Its IUPAC name is 1-[6-[(E)-2-dimethoxyphosphanylethenyl]-4-(2,2,2-trifluoroacetyl)morpholin-2-yl]pyrimidine-2,4-dione;ethane.
| Compound Name | 1-[6-[(E)-2-dimethoxyphosphanylethenyl]-4-(2,2,2-trifluoroacetyl)morpholin-2-yl]pyrimidine-2,4-dione;ethane |
|---|---|
| PubChem CID | 142619507 |
| Molecular Formula | C16H23F3N3O6P |
| Molecular Weight | 441.34 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 1-[6-[(E)-2-dimethoxyphosphanylethenyl]-4-(2,2,2-trifluoroacetyl)morpholin-2-yl]pyrimidine-2,4-dione;ethane |
| SMILES | CC.COP(/C=C/C1CN(C(=O)C(F)(F)F)CC(n2ccc(=O)[nH]c2=O)O1)OC |
| InChI | InChI=1S/C14H17F3N3O6P.C2H6/c1-24-27(25-2)6-4-9-7-19(12(22)14(15,16)17)8-11(26-9)20-5-3-10(21)18-13(20)23;1-2/h3-6,9,11H,7-8H2,1-2H3,(H,18,21,23);1-2H3/b6-4+; |
| InChIKey | KWGRHJDLJRRQBT-CVDVRWGVSA-N |
| XLogP | 1.97 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|