C13H14F6N2O10S2 — CID 169068547
[(3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-methoxy-2-(trifluoromethylsulfonyloxymethyl)oxolan-2-yl]methyl trifluoromethanesulfonate (PubChem CID 169068547) has the molecular formula C13H14F6N2O10S2 and a molecular weight of 536.38 g/mol. Its IUPAC name is [(3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-methoxy-2-(trifluoromethylsulfonyloxymethyl)oxolan-2-yl]methyl trifluoromethanesulfonate.
| Compound Name | [(3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-methoxy-2-(trifluoromethylsulfonyloxymethyl)oxolan-2-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 169068547 |
| Molecular Formula | C13H14F6N2O10S2 |
| Molecular Weight | 536.38 g/mol |
| Exact Mass | 536.00 |
| IUPAC Name | [(3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-methoxy-2-(trifluoromethylsulfonyloxymethyl)oxolan-2-yl]methyl trifluoromethanesulfonate |
| SMILES | CO[C@H]1C[C@H](n2ccc(=O)[nH]c2=O)OC1(COS(=O)(=O)C(F)(F)F)COS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H14F6N2O10S2/c1-28-7-4-9(21-3-2-8(22)20-10(21)23)31-11(7,5-29-32(24,25)12(14,15)16)6-30-33(26,27)13(17,18)19/h2-3,7,9H,4-6H2,1H3,(H,20,22,23)/t7-,9+/m0/s1 |
| InChIKey | PBXJMZQSZOORCW-IONNQARKSA-N |
| XLogP | -0.06 |
| TPSA | 160.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.38 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|