C16H26N2O6Si — CID 57081332
(2S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolane-2-carbaldehyde (PubChem CID 57081332) has the molecular formula C16H26N2O6Si and a molecular weight of 370.48 g/mol. Its IUPAC name is (2S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolane-2-carbaldehyde.
| Compound Name | (2S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 57081332 |
| Molecular Formula | C16H26N2O6Si |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | (2S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolane-2-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OC1C[C@@H](n2ccc(=O)[nH]c2=O)O[C@@]1(C=O)CO |
| InChI | InChI=1S/C16H26N2O6Si/c1-15(2,3)25(4,5)24-11-8-13(23-16(11,9-19)10-20)18-7-6-12(21)17-14(18)22/h6-7,9,11,13,20H,8,10H2,1-5H3,(H,17,21,22)/t11?,13-,16-/m0/s1 |
| InChIKey | JRAMAQRTUZKIHR-DKGPUHFJSA-N |
| XLogP | 0.78 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|